For research use only. Not for therapeutic Use.
6-Methyltryptophan(Cat No.:L020170)is a methylated derivative of the essential amino acid tryptophan, playing a significant role in biochemical and pharmaceutical research. This compound is utilized in studies focused on metabolic pathways, enzyme inhibition, and the biosynthesis of indole alkaloids. As a key building block in the synthesis of bioactive molecules, 6-Methyltryptophan is essential for developing new therapeutic agents and understanding tryptophan-related metabolic processes. Its high purity and consistent quality make it an invaluable tool for advanced research in biochemistry and medicinal chemistry.
CAS Number | 33468-34-7 |
Molecular Formula | C12H14N2O2 |
Purity | ≥95% |
IUPAC Name | (2S)-2-amino-3-(6-methyl-1H-indol-3-yl)propanoic acid |
InChI | InChI=1S/C12H14N2O2/c1-7-2-3-9-8(5-10(13)12(15)16)6-14-11(9)4-7/h2-4,6,10,14H,5,13H2,1H3,(H,15,16)/t10-/m0/s1 |
InChIKey | GDMRVYIFGPMUCG-JTQLQIEISA-N |
SMILES | CC1=CC2=C(C=C1)C(=CN2)CC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |