For research use only. Not for therapeutic Use.
6-Methyluracil, also known as 6-methyl-2,4(1H,3H)-pyrimidinedione(CAT: R006083), is a derivative of uracil, a naturally occurring pyrimidine base found in RNA. In this compound, a methyl group (-CH₃) is attached to the 6-position of the uracil ring. This modification can impact the molecule’s properties, such as its biological activity and reactivity in biochemical processes. 6-Methyluracil has applications in pharmaceuticals, where it is studied for its potential therapeutic effects, particularly in promoting tissue repair and as a radioprotective agent. Its structural similarity to uracil makes it valuable in research related to nucleic acid chemistry and metabolic pathways.
| Catalog Number | R006083 |
| CAS Number | 626-48-2 |
| Synonyms | 6-Methyl-2,4(1H,3H)-pyrimidinedione; 2,4-Dihydroxy-6-methylpyrimidine; NSC 9456; Pseudothymine; |
| Molecular Formula | C5H6N2O2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | Room temperature |
| IUPAC Name | 6-methyl-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C5H6N2O2/c1-3-2-4(8)7-5(9)6-3/h2H,1H3,(H2,6,7,8,9) |
| InChIKey | SHVCSCWHWMSGTE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC(=O)N1 |
