6-Morpholinopyridin-3-amine（Cat No.:L047548）is a heterocyclic compound widely used in pharmaceutical and chemical research. Featuring a pyridine ring with an amine group at the 3-position and a morpholine ring attached at the 6-position, this compound serves as a valuable intermediate in the synthesis of bioactive molecules, including potential therapeutic agents. Its unique structure allows for selective interactions in biological systems, making it crucial in drug discovery and development. Additionally, it is employed in the design of complex organic compounds, contributing to advancements in medicinal chemistry and material science.
| Catalog Number | L047548 |
| CAS Number | 52023-68-4 |
| Molecular Formula | C9H13N3O |
| Purity | ≥95% |
| IUPAC Name | 6-morpholin-4-ylpyridin-3-amine |
| InChI | InChI=1S/C9H13N3O/c10-8-1-2-9(11-7-8)12-3-5-13-6-4-12/h1-2,7H,3-6,10H2 |
| InChIKey | VVTSPTCBHTWXMD-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC=C(C=C2)N |
