For research use only. Not for therapeutic Use.
6-Nitro-1H-indole-3-sulfonyl chloride(Cat No.:L007393), is a chemical compound with the molecular formula C8H5ClN2O4S. It belongs to the sulfonyl chloride family, featuring a sulfonate group (SO2Cl) attached to an indole ring. Sulfonyl chlorides are versatile reagents used in various organic syntheses processes, such as the introduction of sulfonyl groups in pharmaceuticals, agrochemicals, and dyes. The nitro group in this compound adds unique reactivity, enabling it to participate in diverse chemical transformations. Its specific structure and reactivity make it valuable in the development of specialized molecules for research and industrial applications.
CAS Number | 132745-00-7 |
Molecular Formula | C8H5ClN2O4S |
Purity | ≥95% |
IUPAC Name | 6-nitro-1H-indole-3-sulfonyl chloride |
InChI | InChI=1S/C8H5ClN2O4S/c9-16(14,15)8-4-10-7-3-5(11(12)13)1-2-6(7)8/h1-4,10H |
InChIKey | NKYPYESQRSNEOB-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC=C2S(=O)(=O)Cl |