For research use only. Not for therapeutic Use.
(6-Nitroquinolin-2-yl)methanol (Cat.No:L003883) holds pivotal importance in organic chemistry. Its unique nitroquinoline structure imparts distinctive reactivity, making it a valuable building block in the synthesis of specialized compounds. This compound finds applications in pharmaceutical and agrochemical research.
Catalog Number | L003883 |
CAS Number | 889944-45-0 |
Molecular Formula | C10H8N2O3 |
Purity | ≥95% |
IUPAC Name | (6-nitroquinolin-2-yl)methanol |
InChI | InChI=1S/C10H8N2O3/c13-6-8-2-1-7-5-9(12(14)15)3-4-10(7)11-8/h1-5,13H,6H2 |
InChIKey | JDYYLMAWYVNLPY-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=N2)CO)C=C1[N+](=O)[O-] |