For research use only. Not for therapeutic Use.
6-Nitroquinoline(CAT: R070814) is a chemical compound that holds significance in the field of organic chemistry and materials science. It acts as a versatile building block in the synthesis of various organic molecules, including pharmaceutical intermediates and agrochemicals. Its action method involves participating in chemical reactions to form more complex structures, making it a valuable reagent in the laboratory.
| Catalog Number | R070814 |
| CAS Number | 613-50-3 |
| Molecular Formula | C9H6N2O2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 6-nitroquinoline |
| InChI | InChI=1S/C9H6N2O2/c12-11(13)8-3-4-9-7(6-8)2-1-5-10-9/h1-6H |
| InChIKey | SMHPLBXIVNQFBA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)[N+](=O)[O-])N=C1 |
