For research use only. Not for therapeutic Use.
6-Phenyl-2H-pyran-4(3H)-one is an organic compound featuring a pyran ring substituted with a phenyl group at the sixth position and a carbonyl group at the fourth position. Its chemical formula is C₉H₈O₂. This compound is notable for its potential biological activities, including antioxidant and anti-inflammatory properties, making it of interest in medicinal chemistry. The structure allows for various chemical modifications, enhancing its utility in synthetic organic chemistry for developing pharmaceuticals and other bioactive molecules.
CAS Number | 5198-68-5 |
Molecular Formula | C11H10O2 |
Purity | ≥95% |
IUPAC Name | 6-phenyl-2,3-dihydropyran-4-one |
InChI | InChI=1S/C11H10O2/c12-10-6-7-13-11(8-10)9-4-2-1-3-5-9/h1-5,8H,6-7H2 |
InChIKey | SQQDHPWCAVNOOP-UHFFFAOYSA-N |
SMILES | C1COC(=CC1=O)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |