For research use only. Not for therapeutic Use.
6-Phenylhexyltrichlorosilane（Cat No.:M083860） is a specialized organosilicon compound characterized by a phenyl group and a hexyl chain attached to a silicon atom, which is further bonded to three chlorine atoms. This structure renders the molecule highly reactive, particularly useful for surface modifications. It is often employed in the preparation of hydrophobic surfaces and as a coupling agent in the synthesis of silicon-based materials. Its utility lies in providing an interface between organic materials and silicon substrates, enhancing adhesion and stability. This makes it valuable in applications such as coatings, and sealants, and in creating modified material surfaces in various industries.
| Catalog Number | M083860 |
| CAS Number | 18035-33-1 |
| Molecular Formula | C12H17Cl3Si |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | trichloro(6-phenylhexyl)silane |
| InChI | InChI=1S/C12H17Cl3Si/c13-16(14,15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2 |
| InChIKey | ODIAUNNUTSSHMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCCCC[Si](Cl)(Cl)Cl |
