For research use only. Not for therapeutic Use.
6-Phenylpicolinimidamide hydrochloride(Cat No.:L033438)is a vital intermediate used in the synthesis of pharmaceuticals, particularly in the development of nitrogen-containing heterocycles. Its structure, featuring a phenyl group attached to a picolinimidamide core, lends itself to creating bioactive molecules with potential therapeutic applications. This compound is essential in the production of various inhibitors and modulators, making it a valuable building block in medicinal chemistry. Its hydrochloride form enhances solubility and stability, ensuring its effective use in chemical reactions and drug development processes.
CAS Number | 115193-61-8 |
Molecular Formula | C12H12ClN3 |
Purity | ≥95% |
IUPAC Name | 6-phenylpyridine-2-carboximidamide;hydrochloride |
InChI | InChI=1S/C12H11N3.ClH/c13-12(14)11-8-4-7-10(15-11)9-5-2-1-3-6-9;/h1-8H,(H3,13,14);1H |
InChIKey | JOWZLVLBEDUGGT-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=NC(=CC=C2)C(=N)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |