Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 6-(Piperidin-4-yl)pyridin-2-amine dihydrochloride
For research use only. Not for therapeutic Use.
6-(Piperidin-4-yl)pyridin-2-amine dihydrochloride(Cat No.:L018408), is a chemical compound used in organic synthesis and pharmaceutical research. It is a pyridine derivative with a piperidin-4-yl group attached to position 6 and an amino group at position 2 of the pyridine ring. The dihydrochloride form enhances stability and handling. This versatile compound serves as a crucial intermediate in the synthesis of various organic molecules and pharmaceutical agents, making it valuable in drug development and medicinal chemistry research.
CAS Number | 2044704-47-2 |
Molecular Formula | C10H17Cl2N3 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 6-piperidin-4-ylpyridin-2-amine;dihydrochloride |
InChI | InChI=1S/C10H15N3.2ClH/c11-10-3-1-2-9(13-10)8-4-6-12-7-5-8;;/h1-3,8,12H,4-7H2,(H2,11,13);2*1H |
InChIKey | FPFNSNIGRDQOGR-UHFFFAOYSA-N |
SMILES | C1CNCCC1C2=NC(=CC=C2)N.Cl.Cl |