For research use only. Not for therapeutic Use.
6-Piperidinonicotinic acid (Cat.No:M030087) is a chemical compound used in organic synthesis and pharmaceutical research. It is a piperidine derivative with a nicotinic acid moiety. 6-Piperidinonicotinic acid serves as a valuable building block for the development of new drugs and biologically active molecules. Further research explores its potential applications in medicinal chemistry.
CAS Number | 120800-50-2 |
Molecular Formula | C11H14N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-piperidin-1-ylpyridine-3-carboxylic acid |
InChI | InChI=1S/C11H14N2O2/c14-11(15)9-4-5-10(12-8-9)13-6-2-1-3-7-13/h4-5,8H,1-3,6-7H2,(H,14,15) |
InChIKey | QLPWWMSKVYYSEY-UHFFFAOYSA-N |
SMILES | C1CCN(CC1)C2=NC=C(C=C2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |