For research use only. Not for therapeutic Use.
6-Propylpyridin-2-amine(Cat No.:L041236)is a high-purity organic compound crucial for pharmaceutical research and chemical synthesis. Featuring a propyl group at the 6-position and an amine group at the 2-position on a pyridine ring, this compound serves as a versatile intermediate in the development of bioactive molecules, including potential therapeutic agents. Its unique structure makes it particularly valuable in medicinal chemistry for the synthesis of complex organic compounds. Ideal for drug discovery and development, 6-Propylpyridin-2-amine ensures precision and reliability in advanced research applications.
CAS Number | 41995-29-3 |
Molecular Formula | C8H12N2 |
Purity | ≥95% |
IUPAC Name | 6-propylpyridin-2-amine |
InChI | InChI=1S/C8H12N2/c1-2-4-7-5-3-6-8(9)10-7/h3,5-6H,2,4H2,1H3,(H2,9,10) |
InChIKey | JDRTXRTVJTWITJ-UHFFFAOYSA-N |
SMILES | CCCC1=NC(=CC=C1)N |