For research use only, not for therapeutic use.
6-tert-Butyl-2-methylphenol (Cat. No: R070239) can be used in organic chemical and pharmaceutical intermediates, natural and synthetic rubber, polyolefin plastics, adhesives, petroleum lubricants and carbon black synergistic production of antioxidants, UV absorbers.
| Catalog Number | R070239 |
| CAS Number | 2219-82-1 |
| Synonyms | 2-tert-Butyl-6-methylphenol |
| Molecular Formula | C11H16O |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 2-tert-butyl-6-methylphenol |
| InChI | InChI=1S/C11H16O/c1-8-6-5-7-9(10(8)12)11(2,3)4/h5-7,12H,1-4H3 |
| InChIKey | BKZXZGWHTRCFPX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(C)(C)C)O |
