For research use only. Not for therapeutic Use.
6-((start-Butyldimethylsilyl)oxy) hexane-1-amine (Cat No.:L022946) is a chemical compound with a hexane-1-amine backbone substituted by a test-butyldimethylsilyl (TBDMS) group at the 6-position. The TBDMS group serves as a protecting group in organic synthesis to shield the amine functionality from undesired reactions. This compound finds applications as an intermediate in complex molecule synthesis, where protection of the amine group is required during chemical transformations.
CAS Number | 124883-99-4 |
Molecular Formula | C12H29NOSi |
Purity | ≥95% |
IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxyhexan-1-amine |
InChI | InChI=1S/C12H29NOSi/c1-12(2,3)15(4,5)14-11-9-7-6-8-10-13/h6-11,13H2,1-5H3 |
InChIKey | NYXJYUIGQLUHGX-UHFFFAOYSA-N |
SMILES | CC(C)(C)[Si](C)(C)OCCCCCCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |