For research use only. Not for therapeutic Use.
6-Thioguanylic Acid(Cat No.:M088394)is a high-purity nucleotide analogue used extensively in biochemical and pharmaceutical research. It plays a critical role in studying DNA and RNA synthesis, as well as nucleotide metabolism. This compound is particularly valuable for developing antiviral and anticancer therapies due to its ability to interfere with nucleic acid function. 6-Thioguanylic Acid is essential for investigating enzyme activities, such as those of polymerases and kinases, providing insights into cellular processes and disease mechanisms. Its precise reactivity makes it indispensable for advancing research in molecular biology and therapeutic development.
CAS Number | 15867-02-4 |
Synonyms | 6-thioguanylic acid |
Molecular Formula | C10H14N5O7PS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
InChI | InChI=1S/C10H14N5O7PS/c11-10-13-7-4(8(24)14-10)12-2-15(7)9-6(17)5(16)3(22-9)1-21-23(18,19)20/h2-3,5-6,9,16-17H,1H2,(H2,18,19,20)(H3,11,13,14,24)/t3-,5-,6-,9-/m1/s1 |
InChIKey | BPZXYEUJBFHASJ-UUOKFMHZSA-N |
SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)O)O)O)NC(=NC2=S)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |