For research use only. Not for therapeutic Use.
6-(Trifluoromethyl)pyridine-2,3-dicarboxylic acid(CAT: L033682) is a high-purity chemical compound widely utilized in pharmaceutical and chemical research. Featuring a trifluoromethyl group and a dicarboxylic acid moiety on a pyridine ring, it serves as a versatile building block for synthesizing bioactive molecules, agrochemicals, and functional materials. Its unique structure facilitates diverse chemical transformations, including esterification, amide bond formation, and coupling reactions. With consistent performance and reactivity, 6-(Trifluoromethyl)pyridine-2,3-dicarboxylic acid supports innovative applications in medicinal chemistry and materials science, making it a valuable resource for advanced research and development.
| Catalog Number | L033682 |
| CAS Number | 90376-94-6 |
| Molecular Formula | C8H4F3NO4 |
| Purity | ≥95% |
| IUPAC Name | 6-(trifluoromethyl)pyridine-2,3-dicarboxylic acid |
| InChI | InChI=1S/C8H4F3NO4/c9-8(10,11)4-2-1-3(6(13)14)5(12-4)7(15)16/h1-2H,(H,13,14)(H,15,16) |
| InChIKey | LXJKAVDDRGVIQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)C(=O)O)C(F)(F)F |
