For research use only. Not for therapeutic Use.
6-(Trifluoromethyl)pyridine-3,4-diamine(Cat No.:L006721), is a chemical compound characterized by a pyridine ring substituted with trifluoromethyl and two amino groups at the 3rd and 4th positions. This compound is vital in medicinal chemistry and organic synthesis, serving as a key intermediate for the preparation of diverse functionalized pyridines. Its specific structure imparts unique reactivity, enabling its utilization in the creation of complex molecules and pharmaceutical agents. Researchers leverage 6-(Trifluoromethyl)pyridine-3,4-diamine as a versatile building block, contributing significantly to advancements in drug discovery, materials science, and the synthesis of specialty chemicals for various industrial applications.
CAS Number | 438564-37-5 |
Molecular Formula | C6H6F3N3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 6-(trifluoromethyl)pyridine-3,4-diamine |
InChI | InChI=1S/C6H6F3N3/c7-6(8,9)5-1-3(10)4(11)2-12-5/h1-2H,11H2,(H2,10,12) |
InChIKey | ZXYMLNXDEYTMJX-UHFFFAOYSA-N |
SMILES | C1=C(C(=CN=C1C(F)(F)F)N)N |