For research use only. Not for therapeutic Use.
6-(Trifluoromethyl)quinazolin-2-amine(Cat No.:L019566)is a fluorinated quinazoline derivative widely utilized in pharmaceutical research. The presence of a trifluoromethyl group at the 6-position and an amine group at the 2-position enhances its chemical stability and biological activity. This compound serves as a crucial intermediate in the synthesis of various therapeutic agents, particularly those targeting cancer, inflammation, and neurological disorders. Its unique structure makes 6-(Trifluoromethyl)quinazolin-2-amine a valuable building block for medicinal chemists developing innovative drugs and advancing drug discovery efforts.
CAS Number | 190273-94-0 |
Molecular Formula | C9H6F3N3 |
Purity | ≥95% |
IUPAC Name | 6-(trifluoromethyl)quinazolin-2-amine |
InChI | InChI=1S/C9H6F3N3/c10-9(11,12)6-1-2-7-5(3-6)4-14-8(13)15-7/h1-4H,(H2,13,14,15) |
InChIKey | DFOFJSOWTYTIDK-UHFFFAOYSA-N |
SMILES | C1=CC2=NC(=NC=C2C=C1C(F)(F)F)N |