For research use only. Not for therapeutic Use.
6,13-Pentacenequinone(Cat No.:L047812)is a high-purity organic compound widely used in materials science and chemical research. This molecule features a pentacene core with quinone groups at the 6 and 13 positions, making it a valuable intermediate in the synthesis of organic semiconductors and photovoltaic materials. Its unique structure allows for strong electronic properties, making it ideal for applications in organic electronics, including transistors and solar cells. 6,13-Pentacenequinone is essential for advanced research in material science, contributing to the development of innovative electronic devices.
CAS Number | 3029-32-1 |
Molecular Formula | C22H12O2 |
Purity | ≥95% |
IUPAC Name | pentacene-6,13-dione |
InChI | InChI=1S/C22H12O2/c23-21-17-9-13-5-1-2-6-14(13)10-18(17)22(24)20-12-16-8-4-3-7-15(16)11-19(20)21/h1-12H |
InChIKey | UFCVADNIXDUEFZ-UHFFFAOYSA-N |
SMILES | C1=CC=C2C=C3C(=CC2=C1)C(=O)C4=CC5=CC=CC=C5C=C4C3=O |