For research use only. Not for therapeutic Use.
4-[tris(4-formylphenyl)methyl]benzaldehyde(Cat No.:M022613) is a complex organic compound characterized by a central benzene ring substituted with a tris(4-formylphenyl)methyl group. This structure involves three 4-formylphenyl groups attached to a central methyl group, which itself is linked to another benzaldehyde group. The presence of multiple formyl (aldehyde) groups makes it highly reactive and useful in synthetic chemistry, particularly in cross-linking applications to create polymers or complex organic frameworks. Its utility is explored in the development of new materials and catalysis, leveraging its ability to form stable covalent bonds.
CAS Number | 617706-61-3 |
Synonyms | 617706-61-3;4-[tris(4-formylphenyl)methyl]benzaldehyde;Benzaldehyde, 4,4/’,4/’/’,4/’/’/’-methanetetrayltetrakis- |
Molecular Formula | C29H20O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[tris(4-formylphenyl)methyl]benzaldehyde |
InChI | InChI=1S/C29H20O4/c30-17-21-1-9-25(10-2-21)29(26-11-3-22(18-31)4-12-26,27-13-5-23(19-32)6-14-27)28-15-7-24(20-33)8-16-28/h1-20H |
InChIKey | NKFUMXIARBFRPH-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C=O)C(C2=CC=C(C=C2)C=O)(C3=CC=C(C=C3)C=O)C4=CC=C(C=C4)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |