Home
>
Reference Standards>Histone Methyltransferase> 6,6/'-Ureylene-bis(1-naphthol-3-sulfonic acid)
For research use only. Not for therapeutic Use.
6,6′-Ureylene-bis(1-naphthol-3-sulfonic acid)(Cat No.:M068354) is a chemical compound with a complex structure containing two naphthol rings connected by a ureylene bridge, each bearing a sulfonic acid group. Its mode of action and pharmacological effects are not extensively documented, suggesting that it might primarily serve as a chemical intermediate or a starting material for various chemical syntheses. Compounds like 6,6′-Ureylene-bis(1-naphthol-3-sulfonic acid) often find utility in organic synthesis, particularly in the preparation of more complex molecules for pharmaceuticals, agrochemicals, or other specialized applications.
Catalog Number | M068354 |
CAS Number | 134-47-4 |
Molecular Formula | C21H16N2O9S2 |
Purity | ≥95% |
Target | Histone Methyltransferase |
Storage | -20°C |
IUPAC Name | 4-hydroxy-7-[(5-hydroxy-7-sulfonaphthalen-2-yl)carbamoylamino]naphthalene-2-sulfonic acid |
InChI | InChI=1S/C21H16N2O9S2/c24-19-9-15(33(27,28)29)7-11-5-13(1-3-17(11)19)22-21(26)23-14-2-4-18-12(6-14)8-16(10-20(18)25)34(30,31)32/h1-10,24-25H,(H2,22,23,26)(H,27,28,29)(H,30,31,32) |
InChIKey | PCGISRHGYLRXSR-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C(C=C2C=C1NC(=O)NC3=CC4=CC(=CC(=C4C=C3)O)S(=O)(=O)O)S(=O)(=O)O)O |