For research use only. Not for therapeutic Use.
6,7-Difluoroindoline-2,3-dione is a fluorinated heterocyclic compound featuring an indoline backbone with two fluorine atoms at the 6 and 7 positions and a dione functional group at the 2 and 3 positions. This structure imparts unique electronic properties and reactivity, making it of interest in medicinal chemistry and organic synthesis. The compound may exhibit biological activity, potentially serving as a lead structure for developing novel therapeutics. Its fluorine substituents can enhance metabolic stability and selectivity in pharmacological applications.
CAS Number | 158580-95-1 |
Molecular Formula | C8H3F2NO2 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 6,7-difluoro-1H-indole-2,3-dione |
InChI | InChI=1S/C8H3F2NO2/c9-4-2-1-3-6(5(4)10)11-8(13)7(3)12/h1-2H,(H,11,12,13) |
InChIKey | FFHXSUOLKDGHLA-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C2=C1C(=O)C(=O)N2)F)F |