For research use only. Not for therapeutic Use.
6,7-Dihydro-4(5H)-benzofuranone (Cat.No:M073913) is a chemical compound known for its aromatic properties. It serves as a versatile building block in organic synthesis, often used in the creation of various pharmaceutical and agrochemical compounds. Its unique structure makes it valuable in the development of diverse molecules for different applications.
CAS Number | 16806-93-2 |
Molecular Formula | C8H8O2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 6,7-dihydro-5H-1-benzofuran-4-one |
InChI | InChI=1S/C8H8O2/c9-7-2-1-3-8-6(7)4-5-10-8/h4-5H,1-3H2 |
InChIKey | DXWQOYPYNPSVRL-UHFFFAOYSA-N |
SMILES | C1CC2=C(C=CO2)C(=O)C1 |