For research use only. Not for therapeutic Use.
6,7-Dihydro-5H-cyclopenta[b]pyridin-5-ol(CAT: L035698) is a heterocyclic compound featuring a fused cyclopentane-pyridine ring system with a hydroxyl group at the 5-position. This compound is valuable in pharmaceutical and organic synthesis due to its unique structural features, which make it a useful intermediate for developing bioactive molecules such as enzyme inhibitors, receptor modulators, and other therapeutic agents. Its well-defined structure and reactivity enable various chemical transformations, including functionalization and ring-opening reactions. 6,7-Dihydro-5H-cyclopenta[b]pyridin-5-ol is an essential building block for innovative research in medicinal chemistry and fine chemical production.
CAS Number | 1065609-70-2 |
Molecular Formula | C8H9NO |
Purity | ≥95% |
IUPAC Name | 6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol |
InChI | InChI=1S/C8H9NO/c10-8-4-3-7-6(8)2-1-5-9-7/h1-2,5,8,10H,3-4H2 |
InChIKey | NIRSJDGVNWIEOA-UHFFFAOYSA-N |
SMILES | C1CC2=C(C1O)C=CC=N2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |