Home
>
Chemical Reagents>Heterocyclic Building Blocks> 6,7-Dimethoxy-1-phenyl-1,2,3,4-tetrahydro-isoquinoline hydrochloride
For research use only. Not for therapeutic Use.
6,7-Dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline hydrochloride(Cat No.:L007111). It belongs to the class of tetrahydroisoquinolines and consists of a phenyl ring, two methoxys (CH3O-) groups at the 6th and 7th positions, and a hydrochloride salt (-HCl) group. This compound is used in research and pharmaceutical studies as a key intermediate, contributing to the synthesis of various biologically active molecules. Its unique structure makes it valuable in medicinal chemistry research, facilitating the development of potential therapeutic agents and aiding advancements in the pharmaceutical industry, particularly in the field of neuroscience and drug discovery.
CAS Number | 63768-20-7 |
Molecular Formula | C17H20ClNO2 |
Purity | ≥95% |
IUPAC Name | 6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
InChI | InChI=1S/C17H19NO2.ClH/c1-19-15-10-13-8-9-18-17(12-6-4-3-5-7-12)14(13)11-16(15)20-2;/h3-7,10-11,17-18H,8-9H2,1-2H3;1H |
InChIKey | XCBCMNDFDVDUDF-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C(NCCC2=C1)C3=CC=CC=C3)OC.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |