Home
>
Chemical Reagents>Heterocyclic Building Blocks> 6,7-Dimethoxy-3-Methyl-1,2,3,4-Tetrahydroisoquinoline Hydrochloride
For research use only. Not for therapeutic Use.
6,7-Dimethoxy-3-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride(Cat No.:L007110), is a chemical compound with the molecular formula C12H18ClNO2. This compound belongs to the class of tetrahydroisoquinolines and contains a methyl group, two methoxys (CH3O-) groups at the 6th and 7th positions, and a hydrochloride salt (-HCl) group. It is utilized in research and pharmaceutical studies, often serving as a precursor or intermediate in the synthesis of various biologically active compounds. Its unique structure makes it valuable in medicinal chemistry research, contributing to the development of potential therapeutic agents and facilitating advancements in the pharmaceutical industry.
Catalog Number | L007110 |
CAS Number | 6266-97-3 |
Molecular Formula | C12H18ClNO2 |
Purity | ≥95% |
IUPAC Name | 6,7-dimethoxy-3-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
InChI | InChI=1S/C12H17NO2.ClH/c1-8-4-9-5-11(14-2)12(15-3)6-10(9)7-13-8;/h5-6,8,13H,4,7H2,1-3H3;1H |
InChIKey | AFFAKYIZHAGJMU-UHFFFAOYSA-N |
SMILES | CC1CC2=CC(=C(C=C2CN1)OC)OC.Cl |