For research use only. Not for therapeutic Use.
6,7-Dimethoxy-3H-quinolin-4-one is a heterocyclic compound characterized by a quinoline structure with methoxy groups at the 6 and 7 positions. This compound is of interest in medicinal chemistry for its potential pharmacological activities, including antimicrobial, anticancer, and anti-inflammatory properties. The presence of the methoxy substituents can enhance its solubility and biological activity, making it a valuable scaffold for drug development. Researchers explore its applications in synthesizing novel therapeutic agents and investigating its mechanisms of action in various disease models.
CAS Number | 127285-54-5 |
Synonyms | 6,7-Dimethoxy-1,4-dihydro-4-quinolinone |
Molecular Formula | C11H11NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6,7-dimethoxy-1H-quinolin-4-one |
InChI | InChI=1S/C11H11NO3/c1-14-10-5-7-8(6-11(10)15-2)12-4-3-9(7)13/h3-6H,1-2H3,(H,12,13) |
InChIKey | QOGPNCUTXVZQSL-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C(=C1)C(=O)C=CN2)OC |