Home
>
Reference Standards>EGFR>
>
6,7-Dimethoxy-4-[N-(3-chlorophenyl)amino]quinazoline hydrochloride
For research use only. Not for therapeutic Use.
6,7-Dimethoxy-4-[N-(3-chlorophenyl)amino]quinazoline hydrochloride (Cat.No:M037319) is a chemical compound with potential applications in medicinal chemistry. Its quinazoline scaffold is of interest due to its presence in various bioactive molecules. Further research is needed to uncover its specific properties, interactions, and potential pharmaceutical uses.
Catalog Number | M037319 |
CAS Number | 170449-18-0 |
Molecular Formula | C16H15Cl2N3O2 |
Purity | ≥95% |
Target | Protein Tyrosine Kinase/RTK |
Storage | Store at -20℃ |
IUPAC Name | N-(3-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine;hydrochloride |
InChI | InChI=1S/C16H14ClN3O2.ClH/c1-21-14-7-12-13(8-15(14)22-2)18-9-19-16(12)20-11-5-3-4-10(17)6-11;/h3-9H,1-2H3,(H,18,19,20);1H |
InChIKey | WDJDYIUSDDVWKB-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=CC=C3)Cl)OC.Cl |