For research use only. Not for therapeutic Use.
6,7,4′-Trihydroxyisoflavone(Cat No.:M086754) is a natural compound belonging to the class of isoflavones. Its action target involves various biological activities due to its complex chemical structure. The mode of action includes potential antioxidant, anti-inflammatory, and anticancer effects. Pharmacologically, 6,7,4′-Trihydroxyisoflavone has shown promise in various medicinal applications, including its potential as an antioxidant to combat oxidative stress, its role in reducing inflammation, and its ability to inhibit the growth and proliferation of certain cancer cells.
Catalog Number | M086754 |
CAS Number | 17817-31-1 |
Molecular Formula | C15H10O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
InChI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-14-6-13(18)12(17)5-10(14)15(11)19/h1-7,16-18H |
InChIKey | GYLUFQJZYAJQDI-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=COC3=CC(=C(C=C3C2=O)O)O)O |