For research use only. Not for therapeutic Use.
6α-Chloro testosterone (Cat No.:C000765) is a synthetic derivative of testosterone, a naturally occurring male sex hormone. This compound likely holds significance in medicinal chemistry and endocrinology research. The introduction of a chlorine atom at position 6α may alter its interactions with androgen receptors, potentially impacting its androgenic and anabolic effects.
| Catalog Number | C000765 |
| CAS Number | 847674-32-2 |
| Synonyms | (6α,17β)-6-Chloro-17-hydroxy-zndrost-4-en-3-one |
| Molecular Formula | C₁₉H₂₇ClO₂ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | White to Pale Beige Solid |
| Storage | -20°C, Inert atmosphere, Light sensitive |
| IUPAC Name | (6S,8R,9S,10R,13S,14S,17S)-6-chloro-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| InChI | InChI=1S/C19H27ClO2/c1-18-7-5-11(21)9-15(18)16(20)10-12-13-3-4-17(22)19(13,2)8-6-14(12)18/h9,12-14,16-17,22H,3-8,10H2,1-2H3/t12-,13-,14-,16-,17-,18+,19-/m0/s1 |
| InChIKey | LIWCKYLNPCEAMM-QXROXWLYSA-N |
| SMILES | CC12CCC3C(C1CCC2O)CC(C4=CC(=O)CCC34C)Cl |
| Reference | McFarland, K., et al.: Science, 245, 494 (1989), Heckert, L., et al.: Mol. Endocrinol., 12, 1499 (1998), Themmen, A., et al.: Endocr. Rev. 21, 551 (2000), Kumar, R., et al.: Biol. Reprod., 65, 710 (2001), |
