For research use only. Not for therapeutic Use.
6Alpha-Bromopenicillanic Acid (Cat No.:C001092) is a chemical compound derived from penicillin. It contains a bromine atom attached to the penicillin nucleus at the 6-alpha position. This modification enhances its reactivity and potential applications in organic synthesis. 6Alpha-Bromopenicillanic Acid may serve as a precursor in the preparation of various penicillin derivatives and analogs. Its specific properties and uses make it valuable in pharmaceutical research and drug development.
| Catalog Number | C001092 |
| CAS Number | 24138-28-1 |
| Synonyms | (2S,5R,6S)-6-Bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic Acid |
| Molecular Formula | C₈H₁₀BrNO₃S |
| Purity | ≥95% |
| Solubility | Methanol |
| Appearance | Light Brown to Brown Solid |
| Storage | -20°C, Hygroscopic, Light sensitive |
| IUPAC Name | (2S,5R,6S)-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChI | InChI=1S/C8H10BrNO3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,1-2H3,(H,12,13)/t3-,4-,6+/m0/s1 |
| InChIKey | DAVPSCAAXXVSFU-RVJQKOHUSA-N |
| SMILES | CC1(C(N2C(S1)C(C2=O)Br)C(=O)O)C |
| Reference | Gould, I.M., et al.: Drugs Exp. Clin. Res., 17, 187 (1991), Roland, R.K., et al.: J. Infect. Dis., 4, 226 (2000), Bonomo, R.A., et al.: Biochim. Biophys. Acta, 1547, 196 (2001), |
