For research use only. Not for therapeutic Use.
(6R)-5,6,7,8-Tetrahydrobiopterin is a crucial cofactor in various enzymatic reactions, particularly those involved in neurotransmitter synthesis and amino acid metabolism. This natural compound plays a vital role in the production of neurotransmitters like dopamine, serotonin, and norepinephrine, as well as in the synthesis of nitric oxide. BH4 deficiency is associated with various neurological and metabolic disorders, highlighting its importance in human health. Therapeutic interventions aimed at restoring BH4 levels hold promise for treating conditions such as phenylketonuria and certain types of neurotransmitter deficiencies.
CAS Number | 62989-33-7 |
Synonyms | (6R)-5,6,7,8-Tetrahydro-L-biopterin; (6R)-L-erythro-5,6,7,8-Tetrahydrobiopterin |
Molecular Formula | C9H15N5O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | room temperature |
IUPAC Name | (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydro-1H-pteridin-4-one |
InChI | InChI=1S/C9H15N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3-4,6,12,15-16H,2H2,1H3,(H4,10,11,13,14,17)/t3-,4+,6-/m0/s1 |
InChIKey | FNKQXYHWGSIFBK-RPDRRWSUSA-N |
SMILES | CC(C(C1CNC2=C(N1)C(=O)N=C(N2)N)O)O |