For research use only. Not for therapeutic Use.
7β-Hydroxy Cholesterol(CAT: R009253) is a chemically modified derivative of cholesterol, a crucial sterol in animal cell membranes and a precursor to essential compounds such as steroid hormones and bile acids. The presence of a hydroxyl group at the 7β position suggests a specific alteration to cholesterol’s structure, potentially impacting its biological activity or metabolic pathways.
CAS Number | 566-27-8 |
Synonyms | (3β,7β)-Cholest-5-ene-3,7-diol; Cholest-5-ene-3β,7β-diol ; 5-Cholestene-3β,7β-diol; 7β-Hydroxycholest-5-en-3β-ol; |
Molecular Formula | C27H46O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (3S,7R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
InChI | InChI=1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h16-18,20-25,28-29H,6-15H2,1-5H3/t18-,20+,21-,22+,23+,24+,25+,26+,27-/m1/s1 |
InChIKey | OYXZMSRRJOYLLO-KGZHIOMZSA-N |
SMILES | CC(C)CCCC(C)C1CCC2C1(CCC3C2C(C=C4C3(CCC(C4)O)C)O)C |