For research use only. Not for therapeutic Use.
7α-Hydroxy pregnenolone is a naturally occurring steroid hormone and an intermediate in the synthesis of neurosteroids. It is produced from pregnenolone, a precursor to various other steroids, through enzymatic hydroxylation at the 7-alpha position. This compound is particularly significant in the brain, where it serves as a precursor for 7α-hydroxy derivatives of dehydroepiandrosterone (DHEA), which are involved in modulating synaptic function and neural plasticity. Its role is crucial in studying neurodegenerative diseases and cognitive functions.
| Catalog Number | R058038 |
| CAS Number | 30626-96-1 |
| Synonyms | (3β,7α)-3,7-Dihydroxypregn-5-en-20-one; 7α-Hydroxypregnenolone; |
| Molecular Formula | C21H32O3 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 1-[(3S,7S,8S,9S,10R,13S,14S,17S)-3,7-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| InChI | InChI=1S/C21H32O3/c1-12(22)15-4-5-16-19-17(7-9-21(15,16)3)20(2)8-6-14(23)10-13(20)11-18(19)24/h11,14-19,23-24H,4-10H2,1-3H3/t14-,15+,16-,17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | UEWNVBNIVGLQPG-XXHSLLPRSA-N |
| SMILES | CC(=O)C1CCC2C1(CCC3C2C(C=C4C3(CCC(C4)O)C)O)C |
