For research use only. Not for therapeutic Use.
7-Acetoxy-1-methylquinolinium iodide(Cat No.:I014951)is a chemical compound often used in research, particularly in the field of organic chemistry and biochemistry. It is a quaternary ammonium salt where the quinoline structure is modified with an acetoxy group and a methyl group. This compound is primarily utilized in the study of molecular interactions, as it can serve as a fluorescent probe or reagent in various assays. Its unique structure and reactivity make it useful for exploring cell membrane interactions, drug delivery systems, and enzyme inhibition mechanisms in biochemical studies.
Catalog Number | I014951 |
CAS Number | 7270-83-9 |
Molecular Formula | C₁₂H₁₂INO₂ |
Purity | ≥95% |
Target | Cholinesterase (ChE) |
IUPAC Name | (1-methylquinolin-1-ium-7-yl) acetate;iodide |
InChI | InChI=1S/C12H12NO2.HI/c1-9(14)15-11-6-5-10-4-3-7-13(2)12(10)8-11;/h3-8H,1-2H3;1H/q+1;/p-1 |
InChIKey | IFUAVRXVEJBLFI-UHFFFAOYSA-M |
SMILES | CC(=O)OC1=CC2=C(C=CC=[N+]2C)C=C1.[I-] |