For research use only. Not for therapeutic Use.
7-Acetylquinoline-3-carboxylic acid(Cat No.:L025911)is a specialized compound utilized in pharmaceutical and organic synthesis. Featuring a quinoline core with an acetyl group at the 7-position and a carboxylic acid group at the 3-position, this compound serves as a key intermediate in the creation of complex molecules, including potential drug candidates. Its unique structure facilitates diverse chemical transformations, making it valuable in medicinal chemistry for developing new therapeutic agents. This compound is particularly important in advancing research in drug discovery and exploring novel chemical pathways.
Catalog Number | L025911 |
CAS Number | 1956328-33-8 |
Molecular Formula | C12H9NO3 |
Purity | ≥95% |
IUPAC Name | 7-acetylquinoline-3-carboxylic acid |
InChI | InChI=1S/C12H9NO3/c1-7(14)8-2-3-9-4-10(12(15)16)6-13-11(9)5-8/h2-6H,1H3,(H,15,16) |
InChIKey | JORIAGSAUPSQET-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC2=NC=C(C=C2C=C1)C(=O)O |