For research use only. Not for therapeutic Use.
7-Allyl-7,8-dihydro-8-oxoguanosine (Loxoribine) (Cat No.: R006230) is a synthetic nucleoside analog known for its immune-stimulating properties. As a potent activator of Toll-like receptor 7 (TLR7), Loxoribine enhances the immune response, making it a candidate for cancer immunotherapy and antiviral treatments. It has been studied for its ability to induce cytokine production and promote T cell activation. Its unique structure and mechanism of action position it as a valuable tool in immunomodulation and therapeutic interventions targeting immune disorders.
CAS Number | 121288-39-9 |
Synonyms | 7-Allyl-2-amino-9-(3,4-dihydroxy-5-hydroxymethyl-tetrahydro-furan-2-yl)-7,9-dihydro-1H-purine-6,8-dione, Loxoribine |
Molecular Formula | C13H17N5O6 |
Purity | ≥95% |
Target | Anti-infection |
Solubility | Soluble in DMSO > 10 mM |
Storage | Desiccate at +4℃ |
IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione |
InChI | 1S/C13H17N5O6/c1-2-3-17-6-9(15-12(14)16-10(6)22)18(13(17)23)11-8(21)7(20)5(4-19)24-11/h2,5,7-8,11,19-21H,1,3-4H2,(H3,14,15,16,22)/t5-,7-,8-,11-/m1/s1 |
InChIKey | VDCRFBBZFHHYGT-IOSLPCCCSA-N |
SMILES | C=CCN1C2=C(N=C(NC2=O)N)N(C1=O)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |