For research use only. Not for therapeutic Use.
7-Amino-1,5-naphthyridine-3-carboxylic acid is an aromatic heterocyclic compound with a naphthyridine ring system. It features an amino group (-NH₂) at the 7-position, a carboxylic acid group (-COOH) at the 3-position, and a nitrogen atom incorporated into the ring structure. This compound is valuable in organic synthesis, especially in the development of bioactive molecules. It may be explored in medicinal chemistry for potential antimicrobial, anticancer, or antiviral activities, thanks to its ability to interact with biological targets via its functional groups.
CAS Number | 2089649-99-8 |
Molecular Formula | C9H7N3O2 |
Purity | ≥95% |
IUPAC Name | 7-amino-1,5-naphthyridine-3-carboxylic acid |
InChI | InChI=1S/C9H7N3O2/c10-6-2-8-7(12-4-6)1-5(3-11-8)9(13)14/h1-4H,10H2,(H,13,14) |
InChIKey | DRTLZSZLSANJPO-UHFFFAOYSA-N |
SMILES | C1=C(C=NC2=C1N=CC(=C2)N)C(=O)O |