For research use only. Not for therapeutic Use.
7-Amino-3,4-dihydro-1H-quinolin-2-one(CAT: L047505) is a high-purity heterocyclic compound featuring an amino group and a dihydroquinolin-2-one core. This versatile structure makes it a critical intermediate in pharmaceutical research and organic synthesis, particularly in the development of bioactive molecules, small-molecule inhibitors, and therapeutic agents. The amino group allows for targeted functionalization, enabling the synthesis of complex heterocycles and medicinally relevant derivatives. Known for its chemical stability and reactivity, 7-Amino-3,4-dihydro-1H-quinolin-2-one supports precision synthesis in medicinal chemistry, offering reliability and efficiency for both academic and industrial research applications.
Catalog Number | L047505 |
CAS Number | 22246-07-7 |
Molecular Formula | C9H10N2O |
Purity | ≥95% |
IUPAC Name | 7-amino-3,4-dihydro-1H-quinolin-2-one |
InChI | InChI=1S/C9H10N2O/c10-7-3-1-6-2-4-9(12)11-8(6)5-7/h1,3,5H,2,4,10H2,(H,11,12) |
InChIKey | KSQKSHQUEREEKM-UHFFFAOYSA-N |
SMILES | C1CC(=O)NC2=C1C=CC(=C2)N |