For research use only. Not for therapeutic Use.
7-Aminoindole is a versatile chemical compound widely used in pharmaceutical research and organic synthesis. Featuring an amino group at the 7-position of the indole ring, it serves as a key intermediate for the development of various biologically active molecules. Its unique structure allows for modifications that enhance its pharmacological properties, making it valuable in drug discovery. With applications in the synthesis of medicinal agents, 7-Aminoindole is essential for advancing therapeutic innovations and understanding biological processes.
CAS Number | 5192-04-1 |
Molecular Formula | C8H8N2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 1H-indol-7-amine |
InChI | InChI=1S/C8H8N2/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5,10H,9H2 |
InChIKey | WTFWZOSMUGZKNZ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C1)N)NC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |