For research use only. Not for therapeutic Use.
7-(Benzyloxy)-4-chloroquinazoline(Cat No.:L007833), is a chemical compound used in pharmaceutical and research applications. This compound features a quinazoline core structure with a chlorine atom at the 4th position and a benzyloxy (BnO) group attached at the 7th position. Quinazoline derivatives are known for their diverse biological activities and are often explored in drug discovery research. Researchers utilize these compounds as intermediates to synthesize novel molecules with potential pharmacological properties.
CAS Number | 288383-86-8 |
Molecular Formula | C15H11ClN2O |
Purity | ≥95% |
IUPAC Name | 4-chloro-7-phenylmethoxyquinazoline |
InChI | InChI=1S/C15H11ClN2O/c16-15-13-7-6-12(8-14(13)17-10-18-15)19-9-11-4-2-1-3-5-11/h1-8,10H,9H2 |
InChIKey | GXBUBKUDKGUCTI-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=NC=N3)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |