For research use only. Not for therapeutic Use.
7-(Benzyloxy)-8-bromoquinoline(CAT: L000271) is a significant compound in the realm of organic chemistry, specifically in the synthesis of specialized organic molecules. This compound serves as a key building block for the creation of various organic compounds. Its versatility in undergoing various chemical reactions makes it an essential component in organic synthesis.
CAS Number | 1647113-44-7 |
Molecular Formula | C16H12BrNO |
Purity | ≥95% |
IUPAC Name | 8-bromo-7-phenylmethoxyquinoline |
InChI | InChI=1S/C16H12BrNO/c17-15-14(19-11-12-5-2-1-3-6-12)9-8-13-7-4-10-18-16(13)15/h1-10H,11H2 |
InChIKey | GTXZLDCWCDLDLE-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |