For research use only. Not for therapeutic Use.
7-{[(Benzyloxy)carbonyl]amino} (Cat No.:L010334)is a chemical compound used in organic synthesis and pharmaceutical research. It is an amine derivative with a benzyloxy carbonyl (Cbz) protecting group attached to the nitrogen atom. The Cbz group shields the amine functionality during chemical reactions, facilitating the introduction of other functional groups or modifications. This compound serves as a crucial intermediate in the synthesis of various organic molecules and pharmaceutical agents.
Catalog Number | L010334 |
CAS Number | 23434-37-9 |
Molecular Formula | C15H21NO4 |
Purity | ≥95% |
IUPAC Name | 7-(phenylmethoxycarbonylamino)heptanoic acid |
InChI | InChI=1S/C15H21NO4/c17-14(18)10-6-1-2-7-11-16-15(19)20-12-13-8-4-3-5-9-13/h3-5,8-9H,1-2,6-7,10-12H2,(H,16,19)(H,17,18) |
InChIKey | XBVBOABWPAYAFH-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC(=O)NCCCCCCC(=O)O |