For research use only. Not for therapeutic Use.
7-Benzyloxyindole (Cat.No:R006952) is a chemical compound used as a versatile building block in organic synthesis. Its indole ring structure, functionalized with a benzyl ether group, makes it valuable for creating diverse molecules. This compound is widely employed in pharmaceutical and agrochemical research, aiding the development of new compounds with potential therapeutic or agricultural applications.
CAS Number | 20289-27-4 |
Synonyms | 7-(Phenylmethoxy)-1H-indole; 7-(Benzyloxy)-indole; 7-Benzyloxy-1H-indole; NSC 92526; |
Molecular Formula | C15H13NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 7-phenylmethoxy-1H-indole |
InChI | InChI=1S/C15H13NO/c1-2-5-12(6-3-1)11-17-14-8-4-7-13-9-10-16-15(13)14/h1-10,16H,11H2 |
InChIKey | DIGZMTAFOACVBW-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC2=CC=CC3=C2NC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |