For research use only. Not for therapeutic Use.
7-Bromo-1H-indazole is an organic compound with the formula C7H5BrN2. It consists of an indazole ring (a fused bicyclic structure with a nitrogen atom) where a bromine atom is attached at the 7-position. Indazole derivatives like this compound are of interest in medicinal chemistry for their potential bioactivity, including antimicrobial, anti-inflammatory, and anticancer properties. This specific compound may be used as a building block in drug development or as a scaffold for designing other bioactive molecules.
| Catalog Number | L035092 |
| CAS Number | 845751-59-9 |
| Molecular Formula | C7H5BrN2 |
| Purity | ≥95% |
| IUPAC Name | 7-bromo-1H-indazole |
| InChI | InChI=1S/C7H5BrN2/c8-6-3-1-2-5-4-9-10-7(5)6/h1-4H,(H,9,10) |
| InChIKey | KMHHWCPTROQUFM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NN=C2 |
