For research use only. Not for therapeutic Use.
7-Bromo-2-chloroquinoline(CAT: L013715) is a halogenated quinoline derivative known for its reactivity and use as a synthetic intermediate in medicinal chemistry. The presence of both bromine and chlorine atoms on the quinoline ring enhances its utility in cross-coupling reactions, enabling the construction of complex molecular frameworks. This compound is often employed in the development of pharmaceuticals and agrochemicals, as it can serve as a precursor for bioactive heterocyclic compounds. Its structure allows for selective functionalization, making it a valuable building block in the synthesis of molecules aimed at targeting infectious diseases and cancer.
CAS Number | 99455-15-9 |
Molecular Formula | C9H5BrClN |
Purity | ≥95% |
IUPAC Name | 7-bromo-2-chloroquinoline |
InChI | InChI=1S/C9H5BrClN/c10-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5H |
InChIKey | MOEWRAKNXMILKB-UHFFFAOYSA-N |