For research use only. Not for therapeutic Use.
(7-Bromo-2,3-dihydro-1-benzofuran-2-yl)methanol is an organic compound featuring a bromine atom attached to the benzofuran ring at the 7-position and a hydroxymethyl group at the 2-position of the dihydrobenzofuran core. This compound is often used as an intermediate in the synthesis of bioactive molecules, pharmaceuticals, and agrochemicals. Its bromine and hydroxymethyl groups provide versatile sites for further functionalization, making it valuable in organic synthesis. Researchers utilize (7-Bromo-2,3-dihydro-1-benzofuran-2-yl)methanol for its potential in creating novel compounds with diverse biological activities, including applications in medicinal chemistry and drug development.
| Catalog Number | R073420 |
| CAS Number | 852110-51-1 |
| Molecular Formula | C9H9BrO2 |
| Purity | ≥95% |
| IUPAC Name | (7-bromo-2,3-dihydro-1-benzofuran-2-yl)methanol |
| InChI | InChI=1S/C9H9BrO2/c10-8-3-1-2-6-4-7(5-11)12-9(6)8/h1-3,7,11H,4-5H2 |
| InChIKey | KDCRSIHHGGSDPJ-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C1C=CC=C2Br)CO |
