For research use only. Not for therapeutic Use.
7-Bromo-2,3-dihydro-1,8-naphthyridin-4(1H)-one(CAT: L040612) is a brominated heterocyclic compound based on a naphthyridine core, with a bromine atom at the 7-position and a carbonyl group at the 4-position. The 2,3-dihydro structure introduces partial saturation into the naphthyridine ring, which affects its reactivity and biological activity. The bromine atom provides a reactive site for cross-coupling reactions, allowing for further functionalization. This compound is of interest in medicinal chemistry and drug discovery, where naphthyridine derivatives are often explored for their potential as kinase inhibitors, antimicrobial agents, or modulators of biological targets in various therapeutic areas.
CAS Number | 64942-87-6 |
Molecular Formula | C8H7BrN2O |
Purity | ≥95% |
IUPAC Name | 7-bromo-2,3-dihydro-1H-1,8-naphthyridin-4-one |
InChI | InChI=1S/C8H7BrN2O/c9-7-2-1-5-6(12)3-4-10-8(5)11-7/h1-2H,3-4H2,(H,10,11) |
InChIKey | RMXWWJQHIWXRIT-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |