For research use only. Not for therapeutic Use.
7-Bromo-2,4-Diaminoquinazoline(Cat No.:M117005)is a chemical compound commonly used in medicinal chemistry research due to its role as a kinase inhibitor. Its quinazoline core structure makes it a versatile scaffold for developing inhibitors targeting various protein kinases involved in cancer cell growth and survival. This compound is valuable for studying kinase-related signaling pathways and their implications in oncology. By inhibiting these pathways, 7-Bromo-2,4-Diaminoquinazoline contributes to the exploration of novel anticancer therapies, making it a useful tool in drug discovery and cancer research.
CAS Number | 137553-43-6 |
Molecular Formula | C8H7BrN4 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | 7-bromoquinazoline-2,4-diamine |
InChI | InChI=1S/C8H7BrN4/c9-4-1-2-5-6(3-4)12-8(11)13-7(5)10/h1-3H,(H4,10,11,12,13) |
InChIKey | YPWBLOIRVSSESG-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1Br)N=C(N=C2N)N |