For research use only. Not for therapeutic Use.
7-Bromo-2H-chromene-3-carboxylic acid(Cat No.:L007764), is a chemical compound. It belongs to the class of organic compounds known as coumarins, which are compounds with a core structure of 2H-chromen-2-one. This particular compound is distinguished by a carboxylic acid group at the 3-position and a bromine atom at the 7-position on the chromene ring. Compounds like these are often used in medicinal chemistry and drug discovery due to their diverse biological activities, including anticancer, antiviral, and anti-inflammatory properties.
CAS Number | 959858-01-6 |
Molecular Formula | C10H7BrO3 |
Purity | ≥95% |
IUPAC Name | 7-bromo-2H-chromene-3-carboxylic acid |
InChI | InChI=1S/C10H7BrO3/c11-8-2-1-6-3-7(10(12)13)5-14-9(6)4-8/h1-4H,5H2,(H,12,13) |
InChIKey | ZQYIJPPJPBKYEM-UHFFFAOYSA-N |
SMILES | C1C(=CC2=C(O1)C=C(C=C2)Br)C(=O)O |